Showing structure for C[Si](C)(C)N(CCC(=O)C1=CC(O)=CC=C1NC=O)[Si](C)(C)C