Showing structure for C[Si](C)(C)NC(CC(=O)C1=CC(O)=CC=C1N)C(=O)O