Showing structure for C[Si](C)(C)OP(=O)(O)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)O[Se](=O)(=O)O)O[C@@H](N2C=NC3=C(N)N=CN=C32)[C@@H]1O