Showing structure for C=CC(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C