Showing structure for CC(=O)OC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C