Showing structure for CC(C)(C)[Si](C)(C)NC(CC(=O)C1=CC(O)=CC=C1N)C(=O)O[Si](C)(C)C(C)(C)C