Showing structure for CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1O)C[C@@H](C(=O)O)N2