Showing structure for CC1=CC=CC(S(=O)(=O)N(C(CN(C(=O)CC2CC(C3=CC=C(C(=N)N)C=C3)=NO2)[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)=C1