Showing structure for CC1=CC=CC(S(=O)(=O)NC(CNC(=O)CC2CC(C3=CC=C(C(=N[Si](C)(C)C)N[Si](C)(C)C)C=C3)=NO2)C(=O)O)=C1