Showing structure for CCNC(=S)N([Si](C)(C)C)[Si](C)(C)C