Showing structure for CNC(CC(C)CN=C(N)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O