Showing structure for NC(N)=NC(=O)C1=C(N)N=C(N)C(Cl)=N1