Showing structure for OC(=O)[C@@H]1CC2=CC(O)=C(O)C=C2N1