Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2006-08-13 09:57:11 UTC |
---|
Update Date | 2022-03-07 02:49:20 UTC |
---|
HMDB ID | HMDB0004049 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | 20-Hydroxy-PGF2a |
---|
Description | 20-Hydroxy PGF2a is the omega-oxidation product of PGF2alpha via P450 omega-oxidation. Prostaglandin F2a (PGF2) is one of the earliest discovered and most common prostaglandins is actively biosynthesized in various organs of mammals and exhibits a variety of biological activities, including contraction of pulmonary arteries. PGF2 is mainly synthesized directly from PGH2 by PGH2 9,11-endoperoxide reductase. A small amount of PGF2 is also produced from PGE2 by PGE2 9-ketoreductase. A PGF2 epimer has been reported to exhibit various biological activities, and its levels are increased in bronchoalveolar lavage fluid, plasma, and urine in patients with mastocytosis and bronchial asthma. PGF2 is synthesized from PGD2 by PGD2 11-ketoreductase. (PMID: 16475787 , 3473507 ). |
---|
Structure | OCCCCC[C@H](O)\C=C\C1[C@H](O)C[C@H](O)C1C\C=C/CCCC(O)=O InChI=1S/C20H34O6/c21-13-7-3-4-8-15(22)11-12-17-16(18(23)14-19(17)24)9-5-1-2-6-10-20(25)26/h1,5,11-12,15-19,21-24H,2-4,6-10,13-14H2,(H,25,26)/b5-1-,12-11+/t15-,16?,17?,18-,19+/m0/s1 |
---|
Synonyms | Value | Source |
---|
20-Hydroxy-PGF2alpha | HMDB | 9S,11S,15S,20-Tetrahydroxy-5Z,13E-prostadienoate | HMDB | 9S,11S,15S,20-Tetrahydroxy-5Z,13E-prostadienoic acid | HMDB | (5Z)-7-[(3R,5S)-2-[(1E,3S)-3,8-Dihydroxyoct-1-en-1-yl]-3,5-dihydroxycyclopentyl]hept-5-enoate | HMDB |
|
---|
Chemical Formula | C20H34O6 |
---|
Average Molecular Weight | 370.4804 |
---|
Monoisotopic Molecular Weight | 370.23553882 |
---|
IUPAC Name | (5Z)-7-[(3R,5S)-2-[(1E,3S)-3,8-dihydroxyoct-1-en-1-yl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
---|
Traditional Name | 20-hydroxy-PGF2a |
---|
CAS Registry Number | Not Available |
---|
SMILES | OCCCCC[C@H](O)\C=C\C1[C@H](O)C[C@H](O)C1C\C=C/CCCC(O)=O |
---|
InChI Identifier | InChI=1S/C20H34O6/c21-13-7-3-4-8-15(22)11-12-17-16(18(23)14-19(17)24)9-5-1-2-6-10-20(25)26/h1,5,11-12,15-19,21-24H,2-4,6-10,13-14H2,(H,25,26)/b5-1-,12-11+/t15-,16?,17?,18-,19+/m0/s1 |
---|
InChI Key | XQXUYZDBZCLAQO-BFDMEJFDSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as prostaglandins and related compounds. These are unsaturated carboxylic acids consisting of a 20 carbon skeleton that also contains a five member ring, and are based upon the fatty acid arachidonic acid. |
---|
Kingdom | Organic compounds |
---|
Super Class | Lipids and lipid-like molecules |
---|
Class | Fatty Acyls |
---|
Sub Class | Eicosanoids |
---|
Direct Parent | Prostaglandins and related compounds |
---|
Alternative Parents | |
---|
Substituents | - Prostaglandin skeleton
- Long-chain fatty acid
- Hydroxy fatty acid
- Cyclopentanol
- Fatty acid
- Unsaturated fatty acid
- Cyclic alcohol
- Secondary alcohol
- Carboxylic acid derivative
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Hydrocarbon derivative
- Organic oxide
- Organic oxygen compound
- Alcohol
- Primary alcohol
- Carbonyl group
- Organooxygen compound
- Aliphatic homomonocyclic compound
|
---|
Molecular Framework | Aliphatic homomonocyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | Not Available |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | Not Available | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times UnderivatizedChromatographic Method | Retention Time | Reference |
---|
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.88 minutes | 32390414 | Predicted by Siyang on May 30, 2022 | 11.2894 minutes | 33406817 | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.71 minutes | 32390414 | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 160.9 seconds | 40023050 | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2146.7 seconds | 40023050 | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 190.0 seconds | 40023050 | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 133.1 seconds | 40023050 | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 175.9 seconds | 40023050 | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 151.8 seconds | 40023050 | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 383.9 seconds | 40023050 | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 370.8 seconds | 40023050 | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 422.5 seconds | 40023050 | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 905.2 seconds | 40023050 | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 402.0 seconds | 40023050 | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1124.5 seconds | 40023050 | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 281.8 seconds | 40023050 | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 293.4 seconds | 40023050 | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 558.4 seconds | 40023050 | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 232.5 seconds | 40023050 | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 78.3 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
20-Hydroxy-PGF2a,1TMS,isomer #1 | C[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O | 3239.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TMS,isomer #2 | C[Si](C)(C)O[C@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O)CCCCCO | 3238.5 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TMS,isomer #3 | C[Si](C)(C)O[C@@H]1C[C@H](O)C(C/C=C\CCCC(=O)O)C1/C=C/[C@@H](O)CCCCCO | 3168.2 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@@H](O)C(/C=C/[C@@H](O)CCCCCO)C1C/C=C\CCCC(=O)O | 3181.6 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)CCCCCO)[C@H](O)C[C@@H]1O | 3157.1 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #1 | C[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O)O[Si](C)(C)C | 3216.9 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #10 | C[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)CCCCCO)[C@H](O)C[C@@H]1O[Si](C)(C)C | 3102.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #2 | C[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O)C[C@H]1O | 3147.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #3 | C[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C)C[C@H]1O | 3127.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #4 | C[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O[Si](C)(C)C | 3120.0 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@H](CCCCCO)O[Si](C)(C)C)[C@H](O)C[C@@H]1O | 3150.1 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #6 | C[Si](C)(C)O[C@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C)C[C@H]1O)CCCCCO | 3141.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #7 | C[Si](C)(C)O[C@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O[Si](C)(C)C)CCCCCO | 3125.3 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@@H](O[Si](C)(C)C)C(/C=C/[C@@H](O)CCCCCO)C1C/C=C\CCCC(=O)O | 3104.4 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TMS,isomer #9 | C[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)CCCCCO)[C@H](O[Si](C)(C)C)C[C@@H]1O | 3092.6 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #1 | C[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O)C[C@H]1O)O[Si](C)(C)C | 3093.0 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #10 | C[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)CCCCCO)[C@H](O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C | 3022.3 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #2 | C[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C)C[C@H]1O)O[Si](C)(C)C | 3070.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #3 | C[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3066.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #4 | C[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1O | 3033.6 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #5 | C[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O)C[C@H]1O[Si](C)(C)C | 3024.6 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #6 | C[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C | 3038.4 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #7 | C[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@H](CCCCCO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C[C@@H]1O | 3025.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #8 | C[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@H](CCCCCO)O[Si](C)(C)C)[C@H](O)C[C@@H]1O[Si](C)(C)C | 3033.1 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TMS,isomer #9 | C[Si](C)(C)O[C@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C)CCCCCO | 3054.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TMS,isomer #1 | C[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1O)O[Si](C)(C)C | 3022.4 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TMS,isomer #2 | C[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O)C[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3018.2 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TMS,isomer #3 | C[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 2998.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TMS,isomer #4 | C[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C | 2971.2 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@H](CCCCCO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C | 2976.5 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,5TMS,isomer #1 | C[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 2975.9 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O | 3488.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O)CCCCCO | 3473.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](O)C(C/C=C\CCCC(=O)O)C1/C=C/[C@@H](O)CCCCCO | 3389.2 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](O)C(/C=C/[C@@H](O)CCCCCO)C1C/C=C\CCCC(=O)O | 3404.9 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)CCCCCO)[C@H](O)C[C@@H]1O | 3419.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O)O[Si](C)(C)C(C)(C)C | 3733.9 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)CCCCCO)[C@H](O)C[C@@H]1O[Si](C)(C)C(C)(C)C | 3585.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)C[C@H]1O | 3664.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O | 3622.3 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C | 3602.4 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@H](CCCCCO)O[Si](C)(C)C(C)(C)C)[C@H](O)C[C@@H]1O | 3656.6 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O)CCCCCO | 3616.0 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C)CCCCCO | 3604.4 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(/C=C/[C@@H](O)CCCCCO)C1C/C=C\CCCC(=O)O | 3505.1 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)CCCCCO)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O | 3573.8 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)C[C@H]1O)O[Si](C)(C)C(C)(C)C | 3892.4 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)CCCCCO)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C | 3719.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O)O[Si](C)(C)C(C)(C)C | 3827.0 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3829.5 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O | 3788.1 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C | 3783.4 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C | 3722.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@H](CCCCCO)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O | 3790.1 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@H](CCCCCO)O[Si](C)(C)C(C)(C)C)[C@H](O)C[C@@H]1O[Si](C)(C)C(C)(C)C | 3791.2 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C)CCCCCO | 3738.0 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O)O[Si](C)(C)C(C)(C)C | 3998.9 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4002.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OCCCCC[C@@H](/C=C/C1C(C/C=C\CCCC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3966.7 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OCCCCC[C@H](O)/C=C/C1C(C/C=C\CCCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C | 3930.9 | Semi standard non polar | 33892256 | 20-Hydroxy-PGF2a,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CCC/C=C\CC1C(/C=C/[C@H](CCCCCO)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C | 3925.9 | Semi standard non polar | 33892256 |
|
---|