Chromatographic Method | Retention Time | Reference |
---|
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 0.96 minutes | 32390414 |
Predicted by Siyang on May 30, 2022 | 8.6747 minutes | 33406817 |
Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.21 minutes | 32390414 |
AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 382.4 seconds | 40023050 |
Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 459.7 seconds | 40023050 |
Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 350.0 seconds | 40023050 |
Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 62.6 seconds | 40023050 |
Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 248.0 seconds | 40023050 |
RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 122.6 seconds | 40023050 |
Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 271.0 seconds | 40023050 |
BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 233.9 seconds | 40023050 |
HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 797.6 seconds | 40023050 |
UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 560.9 seconds | 40023050 |
BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 38.0 seconds | 40023050 |
UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 630.1 seconds | 40023050 |
SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 220.1 seconds | 40023050 |
RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 347.9 seconds | 40023050 |
MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 695.0 seconds | 40023050 |
KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 500.2 seconds | 40023050 |
Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 408.7 seconds | 40023050 |
Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
3-Oxoalanine,1TMS,isomer #1 | C[Si](C)(C)OC(=O)C(N)C=O | 1122.2 | Semi standard non polar | 33892256 |
3-Oxoalanine,1TMS,isomer #2 | C[Si](C)(C)OC=C(N)C(=O)O | 1303.0 | Semi standard non polar | 33892256 |
3-Oxoalanine,1TMS,isomer #3 | C[Si](C)(C)NC(C=O)C(=O)O | 1184.1 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #1 | C[Si](C)(C)OC=C(N)C(=O)O[Si](C)(C)C | 1342.4 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #1 | C[Si](C)(C)OC=C(N)C(=O)O[Si](C)(C)C | 1277.3 | Standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #1 | C[Si](C)(C)OC=C(N)C(=O)O[Si](C)(C)C | 1940.9 | Standard polar | 33892256 |
3-Oxoalanine,2TMS,isomer #2 | C[Si](C)(C)NC(C=O)C(=O)O[Si](C)(C)C | 1267.8 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #2 | C[Si](C)(C)NC(C=O)C(=O)O[Si](C)(C)C | 1211.0 | Standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #2 | C[Si](C)(C)NC(C=O)C(=O)O[Si](C)(C)C | 1478.2 | Standard polar | 33892256 |
3-Oxoalanine,2TMS,isomer #3 | C[Si](C)(C)NC(=CO[Si](C)(C)C)C(=O)O | 1453.5 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #3 | C[Si](C)(C)NC(=CO[Si](C)(C)C)C(=O)O | 1379.9 | Standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #3 | C[Si](C)(C)NC(=CO[Si](C)(C)C)C(=O)O | 1832.0 | Standard polar | 33892256 |
3-Oxoalanine,2TMS,isomer #4 | C[Si](C)(C)N(C(C=O)C(=O)O)[Si](C)(C)C | 1433.8 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #4 | C[Si](C)(C)N(C(C=O)C(=O)O)[Si](C)(C)C | 1296.2 | Standard non polar | 33892256 |
3-Oxoalanine,2TMS,isomer #4 | C[Si](C)(C)N(C(C=O)C(=O)O)[Si](C)(C)C | 1751.9 | Standard polar | 33892256 |
3-Oxoalanine,3TMS,isomer #1 | C[Si](C)(C)NC(=CO[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1497.8 | Semi standard non polar | 33892256 |
3-Oxoalanine,3TMS,isomer #1 | C[Si](C)(C)NC(=CO[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1401.4 | Standard non polar | 33892256 |
3-Oxoalanine,3TMS,isomer #1 | C[Si](C)(C)NC(=CO[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1675.2 | Standard polar | 33892256 |
3-Oxoalanine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(C=O)N([Si](C)(C)C)[Si](C)(C)C | 1453.4 | Semi standard non polar | 33892256 |
3-Oxoalanine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(C=O)N([Si](C)(C)C)[Si](C)(C)C | 1337.0 | Standard non polar | 33892256 |
3-Oxoalanine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(C=O)N([Si](C)(C)C)[Si](C)(C)C | 1446.8 | Standard polar | 33892256 |
3-Oxoalanine,3TMS,isomer #3 | C[Si](C)(C)OC=C(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1651.0 | Semi standard non polar | 33892256 |
3-Oxoalanine,3TMS,isomer #3 | C[Si](C)(C)OC=C(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1485.2 | Standard non polar | 33892256 |
3-Oxoalanine,3TMS,isomer #3 | C[Si](C)(C)OC=C(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1629.7 | Standard polar | 33892256 |
3-Oxoalanine,4TMS,isomer #1 | C[Si](C)(C)OC=C(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1576.3 | Semi standard non polar | 33892256 |
3-Oxoalanine,4TMS,isomer #1 | C[Si](C)(C)OC=C(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1516.6 | Standard non polar | 33892256 |
3-Oxoalanine,4TMS,isomer #1 | C[Si](C)(C)OC=C(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1539.8 | Standard polar | 33892256 |
3-Oxoalanine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C=O | 1345.2 | Semi standard non polar | 33892256 |
3-Oxoalanine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(N)C(=O)O | 1544.9 | Semi standard non polar | 33892256 |
3-Oxoalanine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(C=O)C(=O)O | 1465.1 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(N)C(=O)O[Si](C)(C)C(C)(C)C | 1784.9 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(N)C(=O)O[Si](C)(C)C(C)(C)C | 1683.5 | Standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(N)C(=O)O[Si](C)(C)C(C)(C)C | 2184.6 | Standard polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(C=O)C(=O)O[Si](C)(C)C(C)(C)C | 1708.7 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(C=O)C(=O)O[Si](C)(C)C(C)(C)C | 1654.7 | Standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(C=O)C(=O)O[Si](C)(C)C(C)(C)C | 1741.4 | Standard polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)C(=O)O | 1962.5 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)C(=O)O | 1765.0 | Standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)C(=O)O | 1989.5 | Standard polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(C=O)C(=O)O)[Si](C)(C)C(C)(C)C | 1850.9 | Semi standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(C=O)C(=O)O)[Si](C)(C)C(C)(C)C | 1720.5 | Standard non polar | 33892256 |
3-Oxoalanine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(C=O)C(=O)O)[Si](C)(C)C(C)(C)C | 1879.8 | Standard polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2114.7 | Semi standard non polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 1952.1 | Standard non polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2003.3 | Standard polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2078.9 | Semi standard non polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 1990.3 | Standard non polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 1830.0 | Standard polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2252.1 | Semi standard non polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2043.8 | Standard non polar | 33892256 |
3-Oxoalanine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 1974.2 | Standard polar | 33892256 |
3-Oxoalanine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2399.2 | Semi standard non polar | 33892256 |
3-Oxoalanine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2207.5 | Standard non polar | 33892256 |
3-Oxoalanine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 1999.7 | Standard polar | 33892256 |