| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Guanosine 2',3'-cyclic phosphate,1TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3052.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,1TMS,isomer #2 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3[NH]C(N)=NC4=O)[C@@H]2O1 | 3066.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,1TMS,isomer #3 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 3082.2 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,1TMS,isomer #4 | C[Si](C)(C)N1C(N)=NC(=O)C2=C1N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 3149.8 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3031.6 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3089.7 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 4774.4 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 3029.8 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 3062.7 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 4985.7 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3117.4 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3094.1 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 5134.9 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O[Si](C)(C)C)O[C@H]31)C=N2 | 3047.6 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O[Si](C)(C)C)O[C@H]31)C=N2 | 3082.4 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O[Si](C)(C)C)O[C@H]31)C=N2 | 4670.8 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #5 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C)C(N)=NC4=O)[C@@H]2O1 | 3117.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #5 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C)C(N)=NC4=O)[C@@H]2O1 | 3123.8 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #5 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C)C(N)=NC4=O)[C@@H]2O1 | 4909.7 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #6 | C[Si](C)(C)N(C1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2)[Si](C)(C)C | 3044.0 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #6 | C[Si](C)(C)N(C1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2)[Si](C)(C)C | 3195.3 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #6 | C[Si](C)(C)N(C1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2)[Si](C)(C)C | 4947.2 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C | 3134.0 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C | 3084.0 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C | 4990.8 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #1 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C)[C@H]3OP(=O)(O[Si](C)(C)C)O[C@H]31)C=N2 | 3024.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #1 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C)[C@H]3OP(=O)(O[Si](C)(C)C)O[C@H]31)C=N2 | 3080.1 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #1 | C[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C)[C@H]3OP(=O)(O[Si](C)(C)C)O[C@H]31)C=N2 | 4383.2 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #2 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3102.5 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #2 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3095.4 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #2 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 4684.7 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3047.5 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3196.0 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 4519.4 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C | 3109.8 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C | 3094.6 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C | 4591.1 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #5 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC4=O)[C@@H]2O1 | 3073.2 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #5 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC4=O)[C@@H]2O1 | 3212.6 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #5 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC4=O)[C@@H]2O1 | 4256.8 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #6 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O[Si](C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C | 3121.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #6 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O[Si](C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C | 3111.6 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #6 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O[Si](C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C | 4332.7 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #7 | C[Si](C)(C)N(C1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C)[Si](C)(C)C | 3171.9 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #7 | C[Si](C)(C)N(C1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C)[Si](C)(C)C | 3230.1 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TMS,isomer #7 | C[Si](C)(C)N(C1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C)[Si](C)(C)C | 4517.6 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3089.6 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3190.8 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 4000.8 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C)[C@H]4OP(=O)(O[Si](C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C | 3120.7 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C)[C@H]4OP(=O)(O[Si](C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C | 3073.5 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C)[C@H]4OP(=O)(O[Si](C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C | 4066.9 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3157.9 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3212.8 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #3 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 4126.3 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #4 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC4=O)[C@@H]2O1 | 3178.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #4 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC4=O)[C@@H]2O1 | 3236.8 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TMS,isomer #4 | C[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC4=O)[C@@H]2O1 | 3934.6 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,5TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3183.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,5TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3181.7 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,5TMS,isomer #1 | C[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@H]12 | 3722.7 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3246.1 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3[NH]C(N)=NC4=O)[C@@H]2O1 | 3264.7 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 3266.9 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N1C(N)=NC(=O)C2=C1N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 3301.1 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 3412.4 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 3432.9 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 4834.0 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 3406.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 3488.8 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OP(=O)(O)O[C@H]31)C=N2 | 4908.9 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3481.9 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3479.7 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 5058.1 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]31)C=N2 | 3421.4 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]31)C=N2 | 3476.4 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]31)C=N2 | 4704.3 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C(C)(C)C)C(N)=NC4=O)[C@@H]2O1 | 3490.6 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C(C)(C)C)C(N)=NC4=O)[C@@H]2O1 | 3474.6 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C(C)(C)C)C(N)=NC4=O)[C@@H]2O1 | 4892.2 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2)[Si](C)(C)C(C)(C)C | 3431.9 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2)[Si](C)(C)C(C)(C)C | 3573.0 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO)[C@H]3OP(=O)(O)O[C@H]31)C=N2)[Si](C)(C)C(C)(C)C | 4789.8 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 3504.1 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 3514.8 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 4800.8 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]31)C=N2 | 3580.5 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]31)C=N2 | 3630.2 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C([NH]1)N([C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]31)C=N2 | 4494.0 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 3653.6 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 3599.1 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 4717.6 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3582.5 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3761.5 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 4502.6 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 3677.5 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 3680.9 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 4548.7 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC4=O)[C@@H]2O1 | 3578.6 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC4=O)[C@@H]2O1 | 3743.6 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC4=O)[C@@H]2O1 | 4337.6 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 3664.1 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 3666.3 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 4383.6 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3680.7 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3784.1 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)C2=C(N([C@@H]3O[C@H](CO)[C@H]4OP(=O)(O)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4441.0 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 3739.1 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 3865.7 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2[NH]C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]12 | 4170.4 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]4OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 3820.3 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]4OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 3746.3 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC1=NC(=O)C2=C(N([C@@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]4OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]43)C=N2)N1[Si](C)(C)C(C)(C)C | 4226.6 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3840.4 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 3896.4 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C=NC3=C2N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC3=O)[C@@H]2OP(=O)(O)O[C@H]12 | 4200.7 | Standard polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC4=O)[C@@H]2O1 | 3824.6 | Semi standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC4=O)[C@@H]2O1 | 3885.8 | Standard non polar | 33892256 |
| Guanosine 2',3'-cyclic phosphate,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@@H]2[C@@H](CO)O[C@@H](N3C=NC4=C3N([Si](C)(C)C(C)(C)C)C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC4=O)[C@@H]2O1 | 4092.5 | Standard polar | 33892256 |