| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2009-02-04 09:42:06 UTC |
|---|
| Update Date | 2021-09-14 15:47:34 UTC |
|---|
| HMDB ID | HMDB0011672 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Aflatoxin B1 dialcohol |
|---|
| Description | Aflatoxin B1 dialcohol is an aflatoxin B1 metabolite. Aflatoxins are naturally occurring mycotoxins that are produced by many species of Aspergillus, a fungus, most notably Aspergillus flavus and Aspergillus parasiticus. At least 13 different types of aflatoxin are produced in nature. Aflatoxin B1 is considered the most toxic and is produced by both Aspergillus flavus and Aspergillus parasiticus. The native habitat of Aspergillus is in soil, decaying vegetation, hay, and grains undergoing microbiological deterioration and it invades all types of organic substrates whenever conditions are favorable for its growth. Favorable conditions include high moisture content (at least 7%) and high temperature. Aflatoxins B1 (AFB1) are contaminants of improperly stored foods; they are potent genotoxic and carcinogenic compounds, exerting their effects through damage to DNA. They can also induce mutations that increase oxidative damage. (PMID: 17214555 ). Crops which are frequently affected by Aspergillus contamination include cereals (maize, sorghum, pearl millet, rice, wheat), oilseeds (peanut, soybean, sunflower, cotton), spices (chile peppers, black pepper, coriander, turmeric, ginger), and tree nuts (almond, pistachio, walnut, coconut, brazil nut). Aflatoxin B1 dialcohol is a derivative of aflatoxin B1 (AFB1) that is formed from AFB1-dihydrodiol (AFB1-dhd) by a novel aldehyde reductase (Aflatoxin B1 aldehyde reductase) (PMID: 1134261 ). Aflatoxin B1 aldehyde reductases (AFARs) are inducible members of the aldo-keto reductase superfamily. They convert aflatoxin B1 dialdehyde derived from the exo- and endo-8,9-epoxides into a number of reduced alcohol products that might be less capable of forming covalent adducts with proteins (PMID: 18266327 ). AFB1 dialdehyde does not bind to DNA but can react with protein lysine groups. There are two principal techniques that can be used to detect levels of aflatoxin in humans. One measures the AFB1-guanine adduct in the urine of subjects. The presence of this breakdown product indicates exposure to aflatoxin B1 in the past 24 hours. The second technique involves the measurement of the AFB1-albumin adduct level in the blood serum. |
|---|
| Structure | COC1=CC2=C(C(CO2)C(O)CO)C2=C1C1=C(C(=O)CC1)C(=O)C2 InChI=1S/C18H18O6/c1-23-14-5-15-17(10(7-24-15)13(22)6-19)9-4-12(21)18-8(16(9)14)2-3-11(18)20/h5,10,13,19,22H,2-4,6-7H2,1H3 |
|---|
| Synonyms | | Value | Source |
|---|
| AFB1 dialcohol | HMDB |
|
|---|
| Chemical Formula | C18H18O6 |
|---|
| Average Molecular Weight | 330.3319 |
|---|
| Monoisotopic Molecular Weight | 330.110338308 |
|---|
| IUPAC Name | 3-(1,2-dihydroxyethyl)-8-methoxy-5-oxatetracyclo[7.7.0.0²,⁶.0¹⁰,¹⁴]hexadeca-1(9),2(6),7,10(14)-tetraene-13,15-dione |
|---|
| Traditional Name | 3-(1,2-dihydroxyethyl)-8-methoxy-5-oxatetracyclo[7.7.0.0²,⁶.0¹⁰,¹⁴]hexadeca-1(9),2(6),7,10(14)-tetraene-13,15-dione |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | COC1=CC2=C(C(CO2)C(O)CO)C2=C1C1=C(C(=O)CC1)C(=O)C2 |
|---|
| InChI Identifier | InChI=1S/C18H18O6/c1-23-14-5-15-17(10(7-24-15)13(22)6-19)9-4-12(21)18-8(16(9)14)2-3-11(18)20/h5,10,13,19,22H,2-4,6-7H2,1H3 |
|---|
| InChI Key | QEIDPNWKOZPLQZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as naphthofurans. Naphthofurans are compounds containing a furan ring fused to a naphthalene moiety. Furan is a 5 membered- ring aromatic ring with four carbon and one oxygen atoms. Naphthalene is a polycyclic aromatic hydrocarbon made up of two fused benzene rings. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Naphthofurans |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Naphthofurans |
|---|
| Alternative Parents | |
|---|
| Substituents | - Naphthofuran
- Naphthalene
- Coumaran
- Anisole
- Alkyl aryl ether
- Benzenoid
- Secondary alcohol
- Ketone
- 1,2-diol
- Oxacycle
- Ether
- Primary alcohol
- Organooxygen compound
- Hydrocarbon derivative
- Carbonyl group
- Organic oxide
- Organic oxygen compound
- Alcohol
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.69 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 10.6261 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.14 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 48.9 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1673.0 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 214.7 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 138.3 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 172.9 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 85.0 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 335.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 407.6 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 223.8 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 818.6 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 341.4 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1094.3 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 241.9 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 301.5 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 381.6 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 258.9 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 95.9 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Aflatoxin B1 dialcohol,1TMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(=O)C3)C(C(CO)O[Si](C)(C)C)CO2 | 2973.5 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,1TMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(=O)C3)C(C(O)CO[Si](C)(C)C)CO2 | 2992.4 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,1TMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C)=CC1)C(C(O)CO)CO2 | 3009.0 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,1TMS,isomer #4 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C)=C3)C(C(O)CO)CO2 | 3109.5 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(=O)C3)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 2996.6 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C)=CC1)C(C(CO)O[Si](C)(C)C)CO2 | 3021.6 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C)=C3)C(C(CO)O[Si](C)(C)C)CO2 | 3089.1 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TMS,isomer #4 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C)=CC1)C(C(O)CO[Si](C)(C)C)CO2 | 3026.6 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TMS,isomer #5 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C)=C3)C(C(O)CO[Si](C)(C)C)CO2 | 3108.1 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TMS,isomer #6 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(O)CO)CO2 | 3128.0 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TMS,isomer #7 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(=O)CCC4=C13)C(C(CO)O[Si](C)(C)C)CO2 | 3089.1 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TMS,isomer #8 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(=O)CCC4=C13)C(C(O)CO[Si](C)(C)C)CO2 | 3108.1 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C)=CC1)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 2998.8 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C)=CC1)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 2949.6 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C)=CC1)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3546.2 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C)=C3)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3081.8 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C)=C3)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3041.3 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C)=C3)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3485.0 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(CO)O[Si](C)(C)C)CO2 | 3078.2 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(CO)O[Si](C)(C)C)CO2 | 2977.3 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(CO)O[Si](C)(C)C)CO2 | 3672.4 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #4 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(=O)CCC4=C13)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3081.8 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #4 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(=O)CCC4=C13)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3041.3 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #4 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(=O)CCC4=C13)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3485.0 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #5 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(O)CO[Si](C)(C)C)CO2 | 3076.2 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #5 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(O)CO[Si](C)(C)C)CO2 | 2987.3 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #5 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(O)CO[Si](C)(C)C)CO2 | 3697.1 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #6 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(CO)O[Si](C)(C)C)CO2 | 3078.2 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #6 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(CO)O[Si](C)(C)C)CO2 | 2977.3 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #6 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(CO)O[Si](C)(C)C)CO2 | 3672.4 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #7 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(O)CO[Si](C)(C)C)CO2 | 3076.2 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #7 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(O)CO[Si](C)(C)C)CO2 | 2987.3 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TMS,isomer #7 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(O)CO[Si](C)(C)C)CO2 | 3697.1 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,4TMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3057.1 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,4TMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 2987.0 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,4TMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C)=CC1)C(O[Si](C)(C)C)=C3)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3423.1 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,4TMS,isomer #2 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3057.1 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,4TMS,isomer #2 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 2987.0 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,4TMS,isomer #2 | COC1=CC2=C(C3=CC(O[Si](C)(C)C)=C4C(O[Si](C)(C)C)=CCC4=C13)C(C(CO[Si](C)(C)C)O[Si](C)(C)C)CO2 | 3423.1 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,1TBDMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(=O)C3)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3201.7 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,1TBDMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(=O)C3)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3215.6 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,1TBDMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C(C)(C)C)=CC1)C(C(O)CO)CO2 | 3232.3 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,1TBDMS,isomer #4 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(O)CO)CO2 | 3342.4 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TBDMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(=O)C3)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3466.4 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TBDMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C(C)(C)C)=CC1)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3479.7 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TBDMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3562.4 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TBDMS,isomer #4 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C(C)(C)C)=CC1)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3474.8 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TBDMS,isomer #5 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3559.3 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TBDMS,isomer #6 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(O)CO)CO2 | 3609.3 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TBDMS,isomer #7 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)CCC4=C13)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3562.4 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,2TBDMS,isomer #8 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)CCC4=C13)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3559.3 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C(C)(C)C)=CC1)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3683.9 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C(C)(C)C)=CC1)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3495.1 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(=O)C3)C(O[Si](C)(C)C(C)(C)C)=CC1)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3769.3 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3762.9 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3692.3 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #2 | COC1=CC2=C(C3=C1C1=C(C(=O)CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3759.5 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3804.8 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3471.8 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #3 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3858.0 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #4 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)CCC4=C13)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3762.9 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #4 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)CCC4=C13)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3692.3 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #4 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(=O)CCC4=C13)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3759.5 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #5 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3798.4 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #5 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3481.8 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #5 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3878.0 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #6 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3804.8 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #6 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3471.8 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #6 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(CO)O[Si](C)(C)C(C)(C)C)CO2 | 3858.0 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #7 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3798.4 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #7 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3481.8 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,3TBDMS,isomer #7 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(O)CO[Si](C)(C)C(C)(C)C)CO2 | 3878.0 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,4TBDMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3972.6 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,4TBDMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3628.1 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,4TBDMS,isomer #1 | COC1=CC2=C(C3=C1C1=C(C(O[Si](C)(C)C(C)(C)C)=CC1)C(O[Si](C)(C)C(C)(C)C)=C3)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3733.0 | Standard polar | 33892256 | | Aflatoxin B1 dialcohol,4TBDMS,isomer #2 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3972.6 | Semi standard non polar | 33892256 | | Aflatoxin B1 dialcohol,4TBDMS,isomer #2 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3628.1 | Standard non polar | 33892256 | | Aflatoxin B1 dialcohol,4TBDMS,isomer #2 | COC1=CC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C4C(O[Si](C)(C)C(C)(C)C)=CCC4=C13)C(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO2 | 3733.0 | Standard polar | 33892256 |
|
|---|