| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.85 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 8.6847 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.58 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 352.7 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 473.9 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 297.5 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 45.8 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 184.4 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 44.5 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 264.3 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 234.4 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 749.1 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 558.7 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 36.3 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 619.7 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 184.9 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 236.8 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 716.2 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 363.5 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 398.5 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)OCC(=O)COC=O | 1664.9 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)OCC(=O)COC=O | 1578.2 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)OCC(=O)COC=O | 2553.6 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #2 | C[Si](C)(C)OC(=COC=O)COP(=O)(O)O | 1790.5 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #2 | C[Si](C)(C)OC(=COC=O)COP(=O)(O)O | 1765.2 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #2 | C[Si](C)(C)OC(=COC=O)COP(=O)(O)O | 3089.3 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #3 | C[Si](C)(C)OC(=COP(=O)(O)O)COC=O | 1689.7 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #3 | C[Si](C)(C)OC(=COP(=O)(O)O)COC=O | 1709.0 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TMS,isomer #3 | C[Si](C)(C)OC(=COP(=O)(O)O)COC=O | 2961.6 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(OCC(=O)COC=O)O[Si](C)(C)C | 1712.2 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(OCC(=O)COC=O)O[Si](C)(C)C | 1648.5 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(OCC(=O)COC=O)O[Si](C)(C)C | 2009.1 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #2 | C[Si](C)(C)OC(=COC=O)COP(=O)(O)O[Si](C)(C)C | 1820.4 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #2 | C[Si](C)(C)OC(=COC=O)COP(=O)(O)O[Si](C)(C)C | 1745.3 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #2 | C[Si](C)(C)OC(=COC=O)COP(=O)(O)O[Si](C)(C)C | 2372.3 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #3 | C[Si](C)(C)OC(=COP(=O)(O)O[Si](C)(C)C)COC=O | 1732.2 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #3 | C[Si](C)(C)OC(=COP(=O)(O)O[Si](C)(C)C)COC=O | 1711.6 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TMS,isomer #3 | C[Si](C)(C)OC(=COP(=O)(O)O[Si](C)(C)C)COC=O | 2305.0 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TMS,isomer #1 | C[Si](C)(C)OC(=COC=O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1849.2 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TMS,isomer #1 | C[Si](C)(C)OC(=COC=O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 1811.0 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TMS,isomer #1 | C[Si](C)(C)OC(=COC=O)COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 2004.0 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TMS,isomer #2 | C[Si](C)(C)OC(=COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)COC=O | 1758.5 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TMS,isomer #2 | C[Si](C)(C)OC(=COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)COC=O | 1762.8 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TMS,isomer #2 | C[Si](C)(C)OC(=COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)COC=O | 1937.8 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)OCC(=O)COC=O | 1885.7 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)OCC(=O)COC=O | 1822.7 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)OCC(=O)COC=O | 2635.7 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O)O | 2016.2 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O)O | 1992.2 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O)O | 3077.0 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O)O)COC=O | 1936.0 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O)O)COC=O | 1926.7 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O)O)COC=O | 2939.9 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(OCC(=O)COC=O)O[Si](C)(C)C(C)(C)C | 2132.1 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(OCC(=O)COC=O)O[Si](C)(C)C(C)(C)C | 2094.1 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(OCC(=O)COC=O)O[Si](C)(C)C(C)(C)C | 2232.7 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2233.3 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2205.4 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O)O[Si](C)(C)C(C)(C)C | 2527.8 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O)O[Si](C)(C)C(C)(C)C)COC=O | 2145.3 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O)O[Si](C)(C)C(C)(C)C)COC=O | 2134.5 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O)O[Si](C)(C)C(C)(C)C)COC=O | 2490.6 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2416.9 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2397.6 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=COC=O)COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2305.5 | Standard polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)COC=O | 2351.0 | Semi standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)COC=O | 2316.9 | Standard non polar | 33892256 |
| Dihydroxyacetone Phosphate Acyl Ester,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)COC=O | 2258.1 | Standard polar | 33892256 |