| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #1 | C[Si](C)(C)NC(N)=NCCCC(NO)C(=O)O[Si](C)(C)C | 2105.8 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #1 | C[Si](C)(C)NC(N)=NCCCC(NO)C(=O)O[Si](C)(C)C | 1805.0 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #1 | C[Si](C)(C)NC(N)=NCCCC(NO)C(=O)O[Si](C)(C)C | 3853.8 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N)N(O)[Si](C)(C)C | 1988.8 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N)N(O)[Si](C)(C)C | 1830.0 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N)N(O)[Si](C)(C)C | 3956.8 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #3 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N[Si](C)(C)C | 2261.8 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #3 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N[Si](C)(C)C | 1793.9 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #3 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N[Si](C)(C)C | 3993.0 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #4 | C[Si](C)(C)N(C(N)=NCCCC(NO)C(=O)O)[Si](C)(C)C | 2214.4 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #4 | C[Si](C)(C)N(C(N)=NCCCC(NO)C(=O)O)[Si](C)(C)C | 1988.0 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #4 | C[Si](C)(C)N(C(N)=NCCCC(NO)C(=O)O)[Si](C)(C)C | 3955.0 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #5 | C[Si](C)(C)NC(N)=NCCCC(C(=O)O)N(O)[Si](C)(C)C | 2164.7 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #5 | C[Si](C)(C)NC(N)=NCCCC(C(=O)O)N(O)[Si](C)(C)C | 1860.8 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TMS,isomer #5 | C[Si](C)(C)NC(N)=NCCCC(C(=O)O)N(O)[Si](C)(C)C | 3912.6 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #1 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C)N[Si](C)(C)C | 2226.8 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #1 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C)N[Si](C)(C)C | 1822.2 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #1 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C)N[Si](C)(C)C | 3520.9 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)NO | 2143.0 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)NO | 1984.5 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)NO | 3595.5 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #3 | C[Si](C)(C)NC(N)=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C | 2139.1 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #3 | C[Si](C)(C)NC(N)=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C | 1876.1 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #3 | C[Si](C)(C)NC(N)=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C | 3695.6 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #4 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2287.6 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #4 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2011.3 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #4 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 3438.4 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #5 | C[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C)N[Si](C)(C)C | 2275.7 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #5 | C[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C)N[Si](C)(C)C | 1853.3 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #5 | C[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C)N[Si](C)(C)C | 3635.3 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #6 | C[Si](C)(C)N(O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2208.5 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #6 | C[Si](C)(C)N(O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2043.8 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TMS,isomer #6 | C[Si](C)(C)N(O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 3684.2 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #1 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2207.5 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #1 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2034.7 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #1 | C[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 3013.6 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #2 | C[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C)N[Si](C)(C)C | 2263.8 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #2 | C[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C)N[Si](C)(C)C | 1884.6 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #2 | C[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C)N[Si](C)(C)C | 3373.1 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)N(O)[Si](C)(C)C | 2220.5 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)N(O)[Si](C)(C)C | 2041.7 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C)[Si](C)(C)C)N(O)[Si](C)(C)C | 3520.9 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #4 | C[Si](C)(C)N(C(=NCCCC(NO)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2319.8 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #4 | C[Si](C)(C)N(C(=NCCCC(NO)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2232.6 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #4 | C[Si](C)(C)N(C(=NCCCC(NO)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2963.2 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #5 | C[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2292.0 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #5 | C[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2079.9 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TMS,isomer #5 | C[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 3212.4 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)NO | 2269.3 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)NO | 2256.8 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)NO | 2606.8 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #2 | C[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2284.1 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #2 | C[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2077.9 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #2 | C[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C)N(O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2974.4 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #3 | C[Si](C)(C)N(O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2357.8 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #3 | C[Si](C)(C)N(O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2286.4 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TMS,isomer #3 | C[Si](C)(C)N(O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2871.4 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,6TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N(O)[Si](C)(C)C | 2371.4 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,6TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N(O)[Si](C)(C)C | 2285.2 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,6TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N(O)[Si](C)(C)C | 2657.2 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C | 2574.9 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C | 2203.0 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C | 3814.4 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N)N(O)[Si](C)(C)C(C)(C)C | 2439.0 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N)N(O)[Si](C)(C)C(C)(C)C | 2296.6 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N)N(O)[Si](C)(C)C(C)(C)C | 3955.6 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N[Si](C)(C)C(C)(C)C | 2726.1 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N[Si](C)(C)C(C)(C)C | 2124.5 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N[Si](C)(C)C(C)(C)C | 3653.4 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(N)=NCCCC(NO)C(=O)O)[Si](C)(C)C(C)(C)C | 2625.3 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(N)=NCCCC(NO)C(=O)O)[Si](C)(C)C(C)(C)C | 2355.9 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(N)=NCCCC(NO)C(=O)O)[Si](C)(C)C(C)(C)C | 3830.9 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C | 2602.3 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C | 2249.0 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C | 3880.1 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 2883.0 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 2315.3 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3399.8 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NO | 2780.6 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NO | 2559.9 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NO | 3648.3 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 2792.5 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 2437.9 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(N)=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 3780.8 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2906.9 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2543.2 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3293.6 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 2923.0 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 2332.2 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3532.0 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2832.2 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2585.1 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3735.6 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3049.5 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2726.3 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=NCCCC(NO)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3115.2 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3099.3 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 2537.2 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C)N[Si](C)(C)C(C)(C)C | 3367.6 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 3059.2 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 2757.4 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 3684.7 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(=NCCCC(NO)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3109.3 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(=NCCCC(NO)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2890.7 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(=NCCCC(NO)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3056.6 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3131.2 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2728.6 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O)N(O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3276.1 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NO | 3270.6 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NO | 3077.5 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)NO | 2911.7 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3308.0 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2906.8 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=NCCCC(C(=O)O[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3187.9 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3341.6 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3060.5 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,5TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3100.7 | Standard polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,6TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 3507.0 | Semi standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,6TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 3254.4 | Standard non polar | 33892256 |
| (2S)-5-(Diaminomethylideneamino)-2-(hydroxyamino)pentanoic Acid,6TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CCCN=C(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N(O)[Si](C)(C)C(C)(C)C | 3048.4 | Standard polar | 33892256 |